![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| %3fC%3dM;O%3dA/ | 2019-07-17 17:56 | - | |
| %3fC%3dN;O%3dD/ | 2019-07-17 17:56 | - | |
| %3fC%3dS;O%3dA/ | 2019-07-17 17:56 | - | |
| Biophysics/ | 2021-08-26 18:46 | - | |
| Clinical Pharmacology/ | 2021-08-26 15:08 | - | |
| European Culture/ | 2021-08-26 15:03 | - | |
| History of Ukraine/ | 2019-07-17 17:56 | - | |
| Leadership in Nursing/ | 2021-08-26 18:46 | - | |
| Medical Informatics/ | 2019-07-17 17:56 | - | |
| Medical statistics/ | 2021-08-26 18:42 | - | |
| Nursing Research/ | 2021-08-26 15:08 | - | |
| Pathological Anatomy/ | 2021-08-26 18:46 | - | |
| Pathological Physiology/ | 2021-08-26 17:37 | - | |
| Philosophy/ | 2021-08-26 12:37 | - | |
| Professional Nursing Role Transition Practicum/ | 2021-08-26 18:46 | - | |
| Ukrainian language/ | 2021-08-26 12:46 | - | |
| biochemistry/ | 2021-08-26 18:42 | - | |
| heath assessment practicum/ | 2019-07-17 18:06 | - | |
| medical biology, parasitology and genetics/ | 2021-08-26 17:36 | - | |