![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 01. Introduction of bioorganic chemistry. Classification, structure, properties of organic.files/ | 2019-07-17 18:37 | - | |
![[ ]](/icons/unknown.gif) | 01. Introduction of bioorganic chemistry. Classification, structure, properties of organic.htm.old | 2019-07-17 18:16 | 285K | |
![[DIR]](/icons/folder.gif) | 03. Classification, structure and properties of carbohydrates..files/ | 2019-07-17 18:37 | - | |
![[ ]](/icons/unknown.gif) | 03. Classification, structure and properties of carbohydrates..htm.old | 2019-07-17 18:16 | 191K | |
![[DIR]](/icons/folder.gif) | 04. Heterocycles. Nucleic acids, classification, structure and biological role..files/ | 2019-07-17 18:37 | - | |
![[ ]](/icons/unknown.gif) | 04. Heterocycles. Nucleic acids, classification, structure and biological role..htm.old | 2019-07-17 18:16 | 142K | |
![[ ]](/icons/unknown.gif) | 05. Amino acids, peptides and proteins.htm.old | 2019-07-17 18:16 | 122K | |
|