![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 01. Introduction into biochemistry. Aminoacid composition, structure of proteins.files/ | 2019-07-17 18:36 | - | |
![[ ]](/icons/unknown.gif) | 01. Introduction into biochemistry. Aminoacid composition, structure of proteins.htm.old | 2019-07-17 18:15 | 339K | |
| 03. Investigation of the enzymatic processes depend on type of reaction, due to the classification of enzymes.files/ | 2019-07-17 18:36 | - | |
| 03. Investigation of the enzymatic processes depend on type of reaction, due to the classification of enzymes.htm.old | 2019-07-17 18:15 | 331K | |
| 04. Investigation of water soluble vitamins.files/ | 2019-07-17 18:36 | - | |
| 04. Investigation of water soluble vitamins.htm.old | 2019-07-17 18:15 | 315K | |
| 05. Investigation of lipid soluble vitamins.files/ | 2019-07-17 18:36 | - | |
| 05. Investigation of lipid soluble vitamins.htm.old | 2019-07-17 18:15 | 382K | |
| 06. Molecular mechanisms of the effect of protein-peptide hormones.files/ | 2019-07-17 18:36 | - | |
| 07. Investigation of thyroid hormones in the regulation of metabolism.files/ | 2019-07-17 18:36 | - | |
![[ ]](/icons/layout.gif) | 07. Investigation of thyroid hormones in the regulation of metabolism.htm | 2019-07-17 18:15 | 501K | |
| 08. Investigation of molecular-cellular mechanisms of adrenal and sex glands hormones.files/ | 2019-07-17 18:36 | - | |
| 08. Investigation of molecular-cellular mechanisms of adrenal and sex glands hormones.htm.old | 2019-07-17 18:15 | 389K | |
| 09. Basic principles of metabolism catabolism, anabolism.files/ | 2019-07-17 18:36 | - | |
| 09. Basic principles of metabolism catabolism, anabolism.htm.old | 2019-07-17 18:15 | 534K | |
| 10. Investigation of biological oxidation, oxidative phosphorylation.files/ | 2019-07-17 18:36 | - | |
| 10. Investigation of biological oxidation, oxidative phosphorylation.htm.old | 2019-07-17 18:15 | 360K | |
| 11. Anaerobic and aerobic oxidation of glucose.files/ | 2019-07-17 18:36 | - | |
| 11. Anaerobic and aerobic oxidation of glucose.htm.old | 2019-07-17 18:15 | 285K | |
| 12. Investigation of catabolism and biosynthesis of glycogen. Regulation of glycogen metabolism.files/ | 2019-07-17 18:36 | - | |
| 13. Investigation of catabolism and biosynthesis of tryacylglycerols.htm | 2019-07-17 18:15 | 411K | |
| 13. Investigation of catabolism and biosynthesis of tryacylglycerols_files/ | 2019-07-17 18:36 | - | |
| 14. Biosynthesis and biotransformation of cholesterol. Metabolism of ketonŠµ bodies. Regulation and disorders of lipid metabolism.htm | 2019-07-17 18:15 | 315K | |
| 15. Digestion of proteins. General pathways of amino acids transformation.files/ | 2019-07-17 18:36 | - | |
| 15. Digestion of proteins. General pathways of amino acids transformation.htm | 2019-07-17 18:15 | 391K | |
| 16. Investigation of detoxification processes and biosynthesis of urea.files/ | 2019-07-17 18:36 | - | |
| 16. Investigation of detoxification processes and biosynthesis of urea.htm.old | 2019-07-17 18:15 | 239K | |
| 17. Biosynthesis and catabolism of purine and pyrimidine nucleotides.files/ | 2019-07-17 18:36 | - | |
| 17. Biosynthesis and catabolism of purine and pyrimidine nucleotides.htm.old | 2019-07-17 18:15 | 292K | |
| 18. Investigation of DNA replication and RNA transcription.files/ | 2019-07-17 18:36 | - | |
| 18. Investigation of DNA replication and RNA transcription.htm.old | 2019-07-17 18:15 | 397K | |
| 19. Biochemistry and pathobiochemistry of blood.files/ | 2019-07-17 18:36 | - | |
| 19. Biochemistry and pathobiochemistry of blood.htm | 2019-07-17 18:15 | 825K | |
| 20. Non-protein nitrogenous containing and nitrogen not containing organic components of blood.files/ | 2019-07-17 18:36 | - | |
| 20. Non-protein nitrogenous containing and nitrogen not containing organic components of blood.htm.old | 2019-07-17 18:15 | 371K | |
| 21. Biochemical functions of liver.htm.old | 2019-07-17 18:15 | 279K | |
| 21. Biochemical functions of liver_files/ | 2019-07-17 18:37 | - | |
| 22. Investigation of physico-chemical properties and chemical composition of normal urine.files/ | 2019-07-17 18:36 | - | |
| 22. Investigation of physico-chemical properties and chemical composition of normal urine.htm.old | 2019-07-17 18:15 | 459K | |
| 23. Biochemistry of muscle, muscle contraction.files/ | 2019-07-17 18:37 | - | |
| 23. Biochemistry of muscle, muscle contraction.htm | 2019-07-17 18:15 | 550K | |
| 24. Biochemistry of connective tissue.files/ | 2019-07-17 18:37 | - | |
| 24. Biochemistry of connective tissue.htm | 2019-07-17 18:15 | 384K | |
|
|---|